About cyclopropanecarboxamide;propanamide
cyclopropanecarboxamide;propanamide (PubChem CID 174752815) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is cyclopropanecarboxamide;propanamide.
Molecular Properties
| Compound Name | cyclopropanecarboxamide;propanamide |
| PubChem CID | 174752815 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | cyclopropanecarboxamide;propanamide |
| SMILES | CCC(N)=O.NC(=O)C1CC1 |
| InChI | InChI=1S/C4H7NO.C3H7NO/c5-4(6)3-1-2-3;1-2-3(4)5/h3H,1-2H2,(H2,5,6);2H2,1H3,(H2,4,5) |
| InChIKey | QOOFKGBTBIRJOD-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropanecarboxamide;propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanecarboxamide;propanamide?
The IUPAC name of cyclopropanecarboxamide;propanamide (CID 174752815) is cyclopropanecarboxamide;propanamide.
What is the SMILES notation for cyclopropanecarboxamide;propanamide?
The canonical SMILES for cyclopropanecarboxamide;propanamide is CCC(N)=O.NC(=O)C1CC1.
What is the InChIKey of cyclopropanecarboxamide;propanamide?
The InChIKey is QOOFKGBTBIRJOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.C3H7NO/c5-4(6)3-1-2-3;1-2-3(4)5/h3H,1-2H2,(H2,5,6);2H2,1H3,(H2,4,5).
What are the key properties of cyclopropanecarboxamide;propanamide?
cyclopropanecarboxamide;propanamide has a molecular weight of 158.20 g/mol, XLogP of -0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanecarboxamide;propanamide is sourced from PubChem (CID 174752815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).