C9H16N2O2 — CID 131039944
4-N-methylcyclohexane-1,4-dicarboxamide (PubChem CID 131039944) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 4-N-methylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-methylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 131039944 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 4-N-methylcyclohexane-1,4-dicarboxamide |
| SMILES | CNC(=O)C1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C9H16N2O2/c1-11-9(13)7-4-2-6(3-5-7)8(10)12/h6-7H,2-5H2,1H3,(H2,10,12)(H,11,13) |
| InChIKey | AXTHGWDNMUJCQY-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |