C12H28N2O — CID 145422265
N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine (PubChem CID 145422265) has the molecular formula C12H28N2O and a molecular weight of 216.37 g/mol. Its IUPAC name is N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine.
| Compound Name | N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine |
|---|---|
| PubChem CID | 145422265 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine |
| SMILES | CC.CN.CNC(=O)C1CCC(C)CC1 |
| InChI | InChI=1S/C9H17NO.C2H6.CH5N/c1-7-3-5-8(6-4-7)9(11)10-2;2*1-2/h7-8H,3-6H2,1-2H3,(H,10,11);1-2H3;2H2,1H3 |
| InChIKey | WDBPFSWOHMGUNK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |