About N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine
N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine (PubChem CID 145422265) has the molecular formula C12H28N2O
and a molecular weight of 216.37 g/mol. Its IUPAC name is N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine.
Molecular Properties
| Compound Name | N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine |
| PubChem CID | 145422265 |
| Molecular Formula | C12H28N2O |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.22 |
| IUPAC Name | N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine |
| SMILES | CC.CN.CNC(=O)C1CCC(C)CC1 |
| InChI | InChI=1S/C9H17NO.C2H6.CH5N/c1-7-3-5-8(6-4-7)9(11)10-2;2*1-2/h7-8H,3-6H2,1-2H3,(H,10,11);1-2H3;2H2,1H3 |
| InChIKey | WDBPFSWOHMGUNK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine?
The IUPAC name of N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine (CID 145422265) is N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine.
What is the SMILES notation for N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine?
The canonical SMILES for N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine is CC.CN.CNC(=O)C1CCC(C)CC1.
What is the InChIKey of N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine?
The InChIKey is WDBPFSWOHMGUNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO.C2H6.CH5N/c1-7-3-5-8(6-4-7)9(11)10-2;2*1-2/h7-8H,3-6H2,1-2H3,(H,10,11);1-2H3;2H2,1H3.
What are the key properties of N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine?
N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine has a molecular weight of 216.37 g/mol, XLogP of 2.16, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,4-dimethylcyclohexane-1-carboxamide;ethane;methanamine is sourced from PubChem (CID 145422265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).