C17H39NO2 — CID 145332702
butane;ethane;N-methoxy-4-methylcyclohexane-1-carboxamide (PubChem CID 145332702) has the molecular formula C17H39NO2 and a molecular weight of 289.50 g/mol. Its IUPAC name is butane;ethane;N-methoxy-4-methylcyclohexane-1-carboxamide.
| Compound Name | butane;ethane;N-methoxy-4-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 145332702 |
| Molecular Formula | C17H39NO2 |
| Molecular Weight | 289.50 g/mol |
| Exact Mass | 289.30 |
| IUPAC Name | butane;ethane;N-methoxy-4-methylcyclohexane-1-carboxamide |
| SMILES | CC.CC.CCCC.CONC(=O)C1CCC(C)CC1 |
| InChI | InChI=1S/C9H17NO2.C4H10.2C2H6/c1-7-3-5-8(6-4-7)9(11)10-12-2;1-3-4-2;2*1-2/h7-8H,3-6H2,1-2H3,(H,10,11);3-4H2,1-2H3;2*1-2H3 |
| InChIKey | COTCRZYKMGSWMS-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|