C14H26N2O2 — CID 70276765
cyclohexane;cyclohexane-1,4-dicarboxamide (PubChem CID 70276765) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is cyclohexane;cyclohexane-1,4-dicarboxamide.
| Compound Name | cyclohexane;cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 70276765 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | cyclohexane;cyclohexane-1,4-dicarboxamide |
| SMILES | C1CCCCC1.NC(=O)C1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C8H14N2O2.C6H12/c9-7(11)5-1-2-6(4-3-5)8(10)12;1-2-4-6-5-3-1/h5-6H,1-4H2,(H2,9,11)(H2,10,12);1-6H2 |
| InChIKey | BRDQROPXJBFUNP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |