About cyclopropanecarboxamide;cyclopropylmethanamine
cyclopropanecarboxamide;cyclopropylmethanamine (PubChem CID 175374528) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is cyclopropanecarboxamide;cyclopropylmethanamine.
Molecular Properties
| Compound Name | cyclopropanecarboxamide;cyclopropylmethanamine |
| PubChem CID | 175374528 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | cyclopropanecarboxamide;cyclopropylmethanamine |
| SMILES | NC(=O)C1CC1.NCC1CC1 |
| InChI | InChI=1S/C4H7NO.C4H9N/c5-4(6)3-1-2-3;5-3-4-1-2-4/h3H,1-2H2,(H2,5,6);4H,1-3,5H2 |
| InChIKey | VHBNMBRWAGRYAB-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropanecarboxamide;cyclopropylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropanecarboxamide;cyclopropylmethanamine?
The IUPAC name of cyclopropanecarboxamide;cyclopropylmethanamine (CID 175374528) is cyclopropanecarboxamide;cyclopropylmethanamine.
What is the SMILES notation for cyclopropanecarboxamide;cyclopropylmethanamine?
The canonical SMILES for cyclopropanecarboxamide;cyclopropylmethanamine is NC(=O)C1CC1.NCC1CC1.
What is the InChIKey of cyclopropanecarboxamide;cyclopropylmethanamine?
The InChIKey is VHBNMBRWAGRYAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.C4H9N/c5-4(6)3-1-2-3;5-3-4-1-2-4/h3H,1-2H2,(H2,5,6);4H,1-3,5H2.
What are the key properties of cyclopropanecarboxamide;cyclopropylmethanamine?
cyclopropanecarboxamide;cyclopropylmethanamine has a molecular weight of 156.23 g/mol, XLogP of 0.24, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropanecarboxamide;cyclopropylmethanamine is sourced from PubChem (CID 175374528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).