About methanol;propanedioic acid
methanol;propanedioic acid (PubChem CID 87156965) has the molecular formula C4H8O5
and a molecular weight of 136.10 g/mol. Its IUPAC name is methanol;propanedioic acid.
Molecular Properties
| Compound Name | methanol;propanedioic acid |
| PubChem CID | 87156965 |
| Molecular Formula | C4H8O5 |
| Molecular Weight | 136.10 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | methanol;propanedioic acid |
| SMILES | CO.O=C(O)CC(=O)O |
| InChI | InChI=1S/C3H4O4.CH4O/c4-2(5)1-3(6)7;1-2/h1H2,(H,4,5)(H,6,7);2H,1H3 |
| InChIKey | SJELIDWGIUVECV-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.10 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methanol;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;propanedioic acid?
The IUPAC name of methanol;propanedioic acid (CID 87156965) is methanol;propanedioic acid.
What is the SMILES notation for methanol;propanedioic acid?
The canonical SMILES for methanol;propanedioic acid is CO.O=C(O)CC(=O)O.
What is the InChIKey of methanol;propanedioic acid?
The InChIKey is SJELIDWGIUVECV-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O4.CH4O/c4-2(5)1-3(6)7;1-2/h1H2,(H,4,5)(H,6,7);2H,1H3.
What are the key properties of methanol;propanedioic acid?
methanol;propanedioic acid has a molecular weight of 136.10 g/mol, XLogP of -0.85, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;propanedioic acid is sourced from PubChem (CID 87156965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).