About ethene;propanedioic acid
ethene;propanedioic acid (PubChem CID 159912302) has the molecular formula C7H12O4
and a molecular weight of 160.17 g/mol. Its IUPAC name is ethene;propanedioic acid.
Molecular Properties
| Compound Name | ethene;propanedioic acid |
| PubChem CID | 159912302 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | ethene;propanedioic acid |
| SMILES | C=C.C=C.O=C(O)CC(=O)O |
| InChI | InChI=1S/C3H4O4.2C2H4/c4-2(5)1-3(6)7;2*1-2/h1H2,(H,4,5)(H,6,7);2*1-2H2 |
| InChIKey | NXIIQNMVUOFSRX-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;propanedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;propanedioic acid?
The IUPAC name of ethene;propanedioic acid (CID 159912302) is ethene;propanedioic acid.
What is the SMILES notation for ethene;propanedioic acid?
The canonical SMILES for ethene;propanedioic acid is C=C.C=C.O=C(O)CC(=O)O.
What is the InChIKey of ethene;propanedioic acid?
The InChIKey is NXIIQNMVUOFSRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O4.2C2H4/c4-2(5)1-3(6)7;2*1-2/h1H2,(H,4,5)(H,6,7);2*1-2H2.
What are the key properties of ethene;propanedioic acid?
ethene;propanedioic acid has a molecular weight of 160.17 g/mol, XLogP of 1.15, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;propanedioic acid is sourced from PubChem (CID 159912302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).