3-oxobutanoic acid

C4H6O3 — CID 96

IUPAC3-oxobutanoic acid
SMILESCC(=O)CC(=O)O
InChIInChI=1S/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7)
InChIKeyWDJHALXBUFZDSR-UHFFFAOYSA-N
MW102.09 g/mol
LogP0.05
Rot. Bonds2

About 3-oxobutanoic acid

3-oxobutanoic acid (PubChem CID 96) has the molecular formula C4H6O3 and a molecular weight of 102.09 g/mol. Its IUPAC name is 3-oxobutanoic acid.

Molecular Properties

Compound Name3-oxobutanoic acid
PubChem CID96
Molecular FormulaC4H6O3
Molecular Weight102.09 g/mol
Exact Mass102.03
IUPAC Name3-oxobutanoic acid
SMILESCC(=O)CC(=O)O
InChIInChI=1S/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7)
InChIKeyWDJHALXBUFZDSR-UHFFFAOYSA-N
XLogP0.05
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms7
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500102.09
LogP ≤ 50.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze 3-oxobutanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-oxobutanoic acid?
The IUPAC name of 3-oxobutanoic acid (CID 96) is 3-oxobutanoic acid.
What is the SMILES notation for 3-oxobutanoic acid?
The canonical SMILES for 3-oxobutanoic acid is CC(=O)CC(=O)O.
What is the InChIKey of 3-oxobutanoic acid?
The InChIKey is WDJHALXBUFZDSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3/c1-3(5)2-4(6)7/h2H2,1H3,(H,6,7).
What are the key properties of 3-oxobutanoic acid?
3-oxobutanoic acid has a molecular weight of 102.09 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutanoic acid is sourced from PubChem (CID 96), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).