About calcium;3-oxobutanoic acid;carbonate
calcium;3-oxobutanoic acid;carbonate (PubChem CID 175960465) has the molecular formula C5H6CaO6
and a molecular weight of 202.17 g/mol. Its IUPAC name is calcium;3-oxobutanoic acid;carbonate.
Molecular Properties
| Compound Name | calcium;3-oxobutanoic acid;carbonate |
| PubChem CID | 175960465 |
| Molecular Formula | C5H6CaO6 |
| Molecular Weight | 202.17 g/mol |
| Exact Mass | 201.98 |
| IUPAC Name | calcium;3-oxobutanoic acid;carbonate |
| SMILES | CC(=O)CC(=O)O.O=C([O-])[O-].[Ca+2] |
| InChI | InChI=1S/C4H6O3.CH2O3.Ca/c1-3(5)2-4(6)7;2-1(3)4;/h2H2,1H3,(H,6,7);(H2,2,3,4);/q;;+2/p-2 |
| InChIKey | MZHMIIHPVAORJF-UHFFFAOYSA-L |
| XLogP | -2.78 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.17 |
| LogP ≤ 5 | -2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze calcium;3-oxobutanoic acid;carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;3-oxobutanoic acid;carbonate?
The IUPAC name of calcium;3-oxobutanoic acid;carbonate (CID 175960465) is calcium;3-oxobutanoic acid;carbonate.
What is the SMILES notation for calcium;3-oxobutanoic acid;carbonate?
The canonical SMILES for calcium;3-oxobutanoic acid;carbonate is CC(=O)CC(=O)O.O=C([O-])[O-].[Ca+2].
What is the InChIKey of calcium;3-oxobutanoic acid;carbonate?
The InChIKey is MZHMIIHPVAORJF-UHFFFAOYSA-L. The full InChI is InChI=1S/C4H6O3.CH2O3.Ca/c1-3(5)2-4(6)7;2-1(3)4;/h2H2,1H3,(H,6,7);(H2,2,3,4);/q;;+2/p-2.
What are the key properties of calcium;3-oxobutanoic acid;carbonate?
calcium;3-oxobutanoic acid;carbonate has a molecular weight of 202.17 g/mol, XLogP of -2.78, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;3-oxobutanoic acid;carbonate is sourced from PubChem (CID 175960465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).