About ethenol;3-oxobutanoic acid
ethenol;3-oxobutanoic acid (PubChem CID 87303365) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is ethenol;3-oxobutanoic acid.
Molecular Properties
| Compound Name | ethenol;3-oxobutanoic acid |
| PubChem CID | 87303365 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | ethenol;3-oxobutanoic acid |
| SMILES | C=CO.CC(=O)CC(=O)O |
| InChI | InChI=1S/C4H6O3.C2H4O/c1-3(5)2-4(6)7;1-2-3/h2H2,1H3,(H,6,7);2-3H,1H2 |
| InChIKey | GDFBQIAKYRJGKH-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze ethenol;3-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenol;3-oxobutanoic acid?
The IUPAC name of ethenol;3-oxobutanoic acid (CID 87303365) is ethenol;3-oxobutanoic acid.
What is the SMILES notation for ethenol;3-oxobutanoic acid?
The canonical SMILES for ethenol;3-oxobutanoic acid is C=CO.CC(=O)CC(=O)O.
What is the InChIKey of ethenol;3-oxobutanoic acid?
The InChIKey is GDFBQIAKYRJGKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.C2H4O/c1-3(5)2-4(6)7;1-2-3/h2H2,1H3,(H,6,7);2-3H,1H2.
What are the key properties of ethenol;3-oxobutanoic acid?
ethenol;3-oxobutanoic acid has a molecular weight of 146.14 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenol;3-oxobutanoic acid is sourced from PubChem (CID 87303365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).