About 3-oxobutanoic acid;propane;zirconium
3-oxobutanoic acid;propane;zirconium (PubChem CID 175002834) has the molecular formula C7H13O3Zr-
and a molecular weight of 236.40 g/mol. Its IUPAC name is 3-oxobutanoic acid;propane;zirconium.
Molecular Properties
| Compound Name | 3-oxobutanoic acid;propane;zirconium |
| PubChem CID | 175002834 |
| Molecular Formula | C7H13O3Zr- |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 234.99 |
| IUPAC Name | 3-oxobutanoic acid;propane;zirconium |
| SMILES | CC(=O)CC(=O)O.C[CH-]C.[Zr] |
| InChI | InChI=1S/C4H6O3.C3H7.Zr/c1-3(5)2-4(6)7;1-3-2;/h2H2,1H3,(H,6,7);3H,1-2H3;/q;-1; |
| InChIKey | CCNIBLTXGDQDRY-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobutanoic acid;propane;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutanoic acid;propane;zirconium?
The IUPAC name of 3-oxobutanoic acid;propane;zirconium (CID 175002834) is 3-oxobutanoic acid;propane;zirconium.
What is the SMILES notation for 3-oxobutanoic acid;propane;zirconium?
The canonical SMILES for 3-oxobutanoic acid;propane;zirconium is CC(=O)CC(=O)O.C[CH-]C.[Zr].
What is the InChIKey of 3-oxobutanoic acid;propane;zirconium?
The InChIKey is CCNIBLTXGDQDRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.C3H7.Zr/c1-3(5)2-4(6)7;1-3-2;/h2H2,1H3,(H,6,7);3H,1-2H3;/q;-1;.
What are the key properties of 3-oxobutanoic acid;propane;zirconium?
3-oxobutanoic acid;propane;zirconium has a molecular weight of 236.40 g/mol, XLogP of 1.28, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutanoic acid;propane;zirconium is sourced from PubChem (CID 175002834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).