About 3-oxobutanoic acid;sulfurous acid
3-oxobutanoic acid;sulfurous acid (PubChem CID 88749298) has the molecular formula C4H8O6S
and a molecular weight of 184.17 g/mol. Its IUPAC name is 3-oxobutanoic acid;sulfurous acid.
Molecular Properties
| Compound Name | 3-oxobutanoic acid;sulfurous acid |
| PubChem CID | 88749298 |
| Molecular Formula | C4H8O6S |
| Molecular Weight | 184.17 g/mol |
| Exact Mass | 184.00 |
| IUPAC Name | 3-oxobutanoic acid;sulfurous acid |
| SMILES | CC(=O)CC(=O)O.O=S(O)O |
| InChI | InChI=1S/C4H6O3.H2O3S/c1-3(5)2-4(6)7;1-4(2)3/h2H2,1H3,(H,6,7);(H2,1,2,3) |
| InChIKey | PWTKMURTWDVLCE-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.17 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 3-oxobutanoic acid;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxobutanoic acid;sulfurous acid?
The IUPAC name of 3-oxobutanoic acid;sulfurous acid (CID 88749298) is 3-oxobutanoic acid;sulfurous acid.
What is the SMILES notation for 3-oxobutanoic acid;sulfurous acid?
The canonical SMILES for 3-oxobutanoic acid;sulfurous acid is CC(=O)CC(=O)O.O=S(O)O.
What is the InChIKey of 3-oxobutanoic acid;sulfurous acid?
The InChIKey is PWTKMURTWDVLCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.H2O3S/c1-3(5)2-4(6)7;1-4(2)3/h2H2,1H3,(H,6,7);(H2,1,2,3).
What are the key properties of 3-oxobutanoic acid;sulfurous acid?
3-oxobutanoic acid;sulfurous acid has a molecular weight of 184.17 g/mol, XLogP of -0.27, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxobutanoic acid;sulfurous acid is sourced from PubChem (CID 88749298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).