About butan-2-one;sulfurous acid
butan-2-one;sulfurous acid (PubChem CID 19882018) has the molecular formula C4H10O4S
and a molecular weight of 154.19 g/mol. Its IUPAC name is butan-2-one;sulfurous acid.
Molecular Properties
| Compound Name | butan-2-one;sulfurous acid |
| PubChem CID | 19882018 |
| Molecular Formula | C4H10O4S |
| Molecular Weight | 154.19 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | butan-2-one;sulfurous acid |
| SMILES | CCC(C)=O.O=S(O)O |
| InChI | InChI=1S/C4H8O.H2O3S/c1-3-4(2)5;1-4(2)3/h3H2,1-2H3;(H2,1,2,3) |
| InChIKey | PXKPKQCNEHVTMN-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.19 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze butan-2-one;sulfurous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-2-one;sulfurous acid?
The IUPAC name of butan-2-one;sulfurous acid (CID 19882018) is butan-2-one;sulfurous acid.
What is the SMILES notation for butan-2-one;sulfurous acid?
The canonical SMILES for butan-2-one;sulfurous acid is CCC(C)=O.O=S(O)O.
What is the InChIKey of butan-2-one;sulfurous acid?
The InChIKey is PXKPKQCNEHVTMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.H2O3S/c1-3-4(2)5;1-4(2)3/h3H2,1-2H3;(H2,1,2,3).
What are the key properties of butan-2-one;sulfurous acid?
butan-2-one;sulfurous acid has a molecular weight of 154.19 g/mol, XLogP of 0.67, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butan-2-one;sulfurous acid is sourced from PubChem (CID 19882018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).