About nickel;3-oxobutanoic acid
nickel;3-oxobutanoic acid (PubChem CID 54611990) has the molecular formula C4H6NiO3
and a molecular weight of 160.78 g/mol. Its IUPAC name is nickel;3-oxobutanoic acid.
Molecular Properties
| Compound Name | nickel;3-oxobutanoic acid |
| PubChem CID | 54611990 |
| Molecular Formula | C4H6NiO3 |
| Molecular Weight | 160.78 g/mol |
| Exact Mass | 159.97 |
| IUPAC Name | nickel;3-oxobutanoic acid |
| SMILES | CC(=O)CC(=O)O.[Ni] |
| InChI | InChI=1S/C4H6O3.Ni/c1-3(5)2-4(6)7;/h2H2,1H3,(H,6,7); |
| InChIKey | SBZKZFCDJZDGCP-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.78 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze nickel;3-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nickel;3-oxobutanoic acid?
The IUPAC name of nickel;3-oxobutanoic acid (CID 54611990) is nickel;3-oxobutanoic acid.
What is the SMILES notation for nickel;3-oxobutanoic acid?
The canonical SMILES for nickel;3-oxobutanoic acid is CC(=O)CC(=O)O.[Ni].
What is the InChIKey of nickel;3-oxobutanoic acid?
The InChIKey is SBZKZFCDJZDGCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O3.Ni/c1-3(5)2-4(6)7;/h2H2,1H3,(H,6,7);.
What are the key properties of nickel;3-oxobutanoic acid?
nickel;3-oxobutanoic acid has a molecular weight of 160.78 g/mol, XLogP of 0.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nickel;3-oxobutanoic acid is sourced from PubChem (CID 54611990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).