About azane;3-oxobutanamide
azane;3-oxobutanamide (PubChem CID 172802770) has the molecular formula C4H10N2O2
and a molecular weight of 118.14 g/mol. Its IUPAC name is azane;3-oxobutanamide.
Molecular Properties
| Compound Name | azane;3-oxobutanamide |
| PubChem CID | 172802770 |
| Molecular Formula | C4H10N2O2 |
| Molecular Weight | 118.14 g/mol |
| Exact Mass | 118.07 |
| IUPAC Name | azane;3-oxobutanamide |
| SMILES | CC(=O)CC(N)=O.N |
| InChI | InChI=1S/C4H7NO2.H3N/c1-3(6)2-4(5)7;/h2H2,1H3,(H2,5,7);1H3 |
| InChIKey | RCBVKHVDFMLDNI-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.14 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze azane;3-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;3-oxobutanamide?
The IUPAC name of azane;3-oxobutanamide (CID 172802770) is azane;3-oxobutanamide.
What is the SMILES notation for azane;3-oxobutanamide?
The canonical SMILES for azane;3-oxobutanamide is CC(=O)CC(N)=O.N.
What is the InChIKey of azane;3-oxobutanamide?
The InChIKey is RCBVKHVDFMLDNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO2.H3N/c1-3(6)2-4(5)7;/h2H2,1H3,(H2,5,7);1H3.
What are the key properties of azane;3-oxobutanamide?
azane;3-oxobutanamide has a molecular weight of 118.14 g/mol, XLogP of -0.39, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;3-oxobutanamide is sourced from PubChem (CID 172802770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).