C17H34N2O4 — CID 160637509
2,2-dimethylheptane;bis(3-oxobutanamide) (PubChem CID 160637509) has the molecular formula C17H34N2O4 and a molecular weight of 330.47 g/mol. Its IUPAC name is 2,2-dimethylheptane;bis(3-oxobutanamide).
| Compound Name | 2,2-dimethylheptane;bis(3-oxobutanamide) |
|---|---|
| PubChem CID | 160637509 |
| Molecular Formula | C17H34N2O4 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.25 |
| IUPAC Name | 2,2-dimethylheptane;bis(3-oxobutanamide) |
| SMILES | CC(=O)CC(N)=O.CC(=O)CC(N)=O.CCCCCC(C)(C)C |
| InChI | InChI=1S/C9H20.2C4H7NO2/c1-5-6-7-8-9(2,3)4;2*1-3(6)2-4(5)7/h5-8H2,1-4H3;2*2H2,1H3,(H2,5,7) |
| InChIKey | RISQXQYGJJAJIE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|