About formaldehyde;propanediamide
formaldehyde;propanediamide (PubChem CID 161283557) has the molecular formula C4H8N2O3
and a molecular weight of 132.12 g/mol. Its IUPAC name is formaldehyde;propanediamide.
Molecular Properties
| Compound Name | formaldehyde;propanediamide |
| PubChem CID | 161283557 |
| Molecular Formula | C4H8N2O3 |
| Molecular Weight | 132.12 g/mol |
| Exact Mass | 132.05 |
| IUPAC Name | formaldehyde;propanediamide |
| SMILES | C=O.NC(=O)CC(N)=O |
| InChI | InChI=1S/C3H6N2O2.CH2O/c4-2(6)1-3(5)7;1-2/h1H2,(H2,4,6)(H2,5,7);1H2 |
| InChIKey | VFKKHUDFTROCRB-UHFFFAOYSA-N |
| XLogP | -1.84 |
| TPSA | 103.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.12 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze formaldehyde;propanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;propanediamide?
The IUPAC name of formaldehyde;propanediamide (CID 161283557) is formaldehyde;propanediamide.
What is the SMILES notation for formaldehyde;propanediamide?
The canonical SMILES for formaldehyde;propanediamide is C=O.NC(=O)CC(N)=O.
What is the InChIKey of formaldehyde;propanediamide?
The InChIKey is VFKKHUDFTROCRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O2.CH2O/c4-2(6)1-3(5)7;1-2/h1H2,(H2,4,6)(H2,5,7);1H2.
What are the key properties of formaldehyde;propanediamide?
formaldehyde;propanediamide has a molecular weight of 132.12 g/mol, XLogP of -1.84, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;propanediamide is sourced from PubChem (CID 161283557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).