About formaldehyde;urea;hydrochloride
formaldehyde;urea;hydrochloride (PubChem CID 158235523) has the molecular formula C2H7ClN2O2
and a molecular weight of 126.54 g/mol. Its IUPAC name is formaldehyde;urea;hydrochloride.
Molecular Properties
| Compound Name | formaldehyde;urea;hydrochloride |
| PubChem CID | 158235523 |
| Molecular Formula | C2H7ClN2O2 |
| Molecular Weight | 126.54 g/mol |
| Exact Mass | 126.02 |
| IUPAC Name | formaldehyde;urea;hydrochloride |
| SMILES | C=O.Cl.NC(N)=O |
| InChI | InChI=1S/CH4N2O.CH2O.ClH/c2-1(3)4;1-2;/h(H4,2,3,4);1H2;1H |
| InChIKey | GEXJANJZUIQADU-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.54 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze formaldehyde;urea;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;urea;hydrochloride?
The IUPAC name of formaldehyde;urea;hydrochloride (CID 158235523) is formaldehyde;urea;hydrochloride.
What is the SMILES notation for formaldehyde;urea;hydrochloride?
The canonical SMILES for formaldehyde;urea;hydrochloride is C=O.Cl.NC(N)=O.
What is the InChIKey of formaldehyde;urea;hydrochloride?
The InChIKey is GEXJANJZUIQADU-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.CH2O.ClH/c2-1(3)4;1-2;/h(H4,2,3,4);1H2;1H.
What are the key properties of formaldehyde;urea;hydrochloride?
formaldehyde;urea;hydrochloride has a molecular weight of 126.54 g/mol, XLogP of -0.74, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;urea;hydrochloride is sourced from PubChem (CID 158235523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).