About CID 159010976
CID 159010976 (PubChem CID 159010976) has the molecular formula CH4K2N2O
and a molecular weight of 138.25 g/mol.
Molecular Properties
| Compound Name | CID 159010976 |
| PubChem CID | 159010976 |
| Molecular Formula | CH4K2N2O |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 137.96 |
| IUPAC Name | — |
| SMILES | NC(N)=O.[K].[K] |
| InChI | InChI=1S/CH4N2O.2K/c2-1(3)4;;/h(H4,2,3,4);; |
| InChIKey | JSMCZRXTTNWVIF-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 159010976 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159010976?
The IUPAC name of CID 159010976 (CID 159010976) is not available.
What is the SMILES notation for CID 159010976?
The canonical SMILES for CID 159010976 is NC(N)=O.[K].[K].
What is the InChIKey of CID 159010976?
The InChIKey is JSMCZRXTTNWVIF-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.2K/c2-1(3)4;;/h(H4,2,3,4);;.
What are the key properties of CID 159010976?
CID 159010976 has a molecular weight of 138.25 g/mol, XLogP of -1.74, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159010976 is sourced from PubChem (CID 159010976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).