About barium(2+);urea
barium(2+);urea (PubChem CID 22402807) has the molecular formula CH4BaN2O+2
and a molecular weight of 197.38 g/mol. Its IUPAC name is barium(2+);urea.
Molecular Properties
| Compound Name | barium(2+);urea |
| PubChem CID | 22402807 |
| Molecular Formula | CH4BaN2O+2 |
| Molecular Weight | 197.38 g/mol |
| Exact Mass | 197.94 |
| IUPAC Name | barium(2+);urea |
| SMILES | NC(N)=O.[Ba+2] |
| InChI | InChI=1S/CH4N2O.Ba/c2-1(3)4;/h(H4,2,3,4);/q;+2 |
| InChIKey | MTVLQDSYOPJFNG-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.38 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze barium(2+);urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);urea?
The IUPAC name of barium(2+);urea (CID 22402807) is barium(2+);urea.
What is the SMILES notation for barium(2+);urea?
The canonical SMILES for barium(2+);urea is NC(N)=O.[Ba+2].
What is the InChIKey of barium(2+);urea?
The InChIKey is MTVLQDSYOPJFNG-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.Ba/c2-1(3)4;/h(H4,2,3,4);/q;+2.
What are the key properties of barium(2+);urea?
barium(2+);urea has a molecular weight of 197.38 g/mol, XLogP of -1.36, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);urea is sourced from PubChem (CID 22402807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).