About bis(oxygen(2-));titanium(4+);urea
bis(oxygen(2-));titanium(4+);urea (PubChem CID 160875609) has the molecular formula CH4N2O3Ti
and a molecular weight of 139.92 g/mol. Its IUPAC name is bis(oxygen(2-));titanium(4+);urea.
Molecular Properties
| Compound Name | bis(oxygen(2-));titanium(4+);urea |
| PubChem CID | 160875609 |
| Molecular Formula | CH4N2O3Ti |
| Molecular Weight | 139.92 g/mol |
| Exact Mass | 139.97 |
| IUPAC Name | bis(oxygen(2-));titanium(4+);urea |
| SMILES | NC(N)=O.[O-2].[O-2].[Ti+4] |
| InChI | InChI=1S/CH4N2O.2O.Ti/c2-1(3)4;;;/h(H4,2,3,4);;;/q;2*-2;+4 |
| InChIKey | SMISQOLGTCDORB-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 126.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.92 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze bis(oxygen(2-));titanium(4+);urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(oxygen(2-));titanium(4+);urea?
The IUPAC name of bis(oxygen(2-));titanium(4+);urea (CID 160875609) is bis(oxygen(2-));titanium(4+);urea.
What is the SMILES notation for bis(oxygen(2-));titanium(4+);urea?
The canonical SMILES for bis(oxygen(2-));titanium(4+);urea is NC(N)=O.[O-2].[O-2].[Ti+4].
What is the InChIKey of bis(oxygen(2-));titanium(4+);urea?
The InChIKey is SMISQOLGTCDORB-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.2O.Ti/c2-1(3)4;;;/h(H4,2,3,4);;;/q;2*-2;+4.
What are the key properties of bis(oxygen(2-));titanium(4+);urea?
bis(oxygen(2-));titanium(4+);urea has a molecular weight of 139.92 g/mol, XLogP of -1.22, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bis(oxygen(2-));titanium(4+);urea is sourced from PubChem (CID 160875609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).