About CID 88605054
CID 88605054 (PubChem CID 88605054) has the molecular formula CH4N2Na2O
and a molecular weight of 106.04 g/mol.
Molecular Properties
| Compound Name | CID 88605054 |
| PubChem CID | 88605054 |
| Molecular Formula | CH4N2Na2O |
| Molecular Weight | 106.04 g/mol |
| Exact Mass | 106.01 |
| IUPAC Name | — |
| SMILES | NC(N)=O.[Na].[Na] |
| InChI | InChI=1S/CH4N2O.2Na/c2-1(3)4;;/h(H4,2,3,4);; |
| InChIKey | HBQCWSFATJDAOY-UHFFFAOYSA-N |
| XLogP | -1.74 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 106.04 |
| LogP ≤ 5 | -1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 88605054 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88605054?
The IUPAC name of CID 88605054 (CID 88605054) is not available.
What is the SMILES notation for CID 88605054?
The canonical SMILES for CID 88605054 is NC(N)=O.[Na].[Na].
What is the InChIKey of CID 88605054?
The InChIKey is HBQCWSFATJDAOY-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.2Na/c2-1(3)4;;/h(H4,2,3,4);;.
What are the key properties of CID 88605054?
CID 88605054 has a molecular weight of 106.04 g/mol, XLogP of -1.74, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88605054 is sourced from PubChem (CID 88605054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).