About niobium;urea
niobium;urea (PubChem CID 159338844) has the molecular formula CH4N2NbO
and a molecular weight of 152.96 g/mol. Its IUPAC name is niobium;urea.
Molecular Properties
| Compound Name | niobium;urea |
| PubChem CID | 159338844 |
| Molecular Formula | CH4N2NbO |
| Molecular Weight | 152.96 g/mol |
| Exact Mass | 152.94 |
| IUPAC Name | niobium;urea |
| SMILES | NC(N)=O.[Nb] |
| InChI | InChI=1S/CH4N2O.Nb/c2-1(3)4;/h(H4,2,3,4); |
| InChIKey | LFWQTSAUGMMQHZ-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.96 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze niobium;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of niobium;urea?
The IUPAC name of niobium;urea (CID 159338844) is niobium;urea.
What is the SMILES notation for niobium;urea?
The canonical SMILES for niobium;urea is NC(N)=O.[Nb].
What is the InChIKey of niobium;urea?
The InChIKey is LFWQTSAUGMMQHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.Nb/c2-1(3)4;/h(H4,2,3,4);.
What are the key properties of niobium;urea?
niobium;urea has a molecular weight of 152.96 g/mol, XLogP of -0.98, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for niobium;urea is sourced from PubChem (CID 159338844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).