About samarium;urea
samarium;urea (PubChem CID 175944196) has the molecular formula CH4N2OSm
and a molecular weight of 210.42 g/mol. Its IUPAC name is samarium;urea.
Molecular Properties
| Compound Name | samarium;urea |
| PubChem CID | 175944196 |
| Molecular Formula | CH4N2OSm |
| Molecular Weight | 210.42 g/mol |
| Exact Mass | 211.95 |
| IUPAC Name | samarium;urea |
| SMILES | NC(N)=O.[Sm] |
| InChI | InChI=1S/CH4N2O.Sm/c2-1(3)4;/h(H4,2,3,4); |
| InChIKey | PFOYGOBBQIRLTB-UHFFFAOYSA-N |
| XLogP | -0.98 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.42 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze samarium;urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of samarium;urea?
The IUPAC name of samarium;urea (CID 175944196) is samarium;urea.
What is the SMILES notation for samarium;urea?
The canonical SMILES for samarium;urea is NC(N)=O.[Sm].
What is the InChIKey of samarium;urea?
The InChIKey is PFOYGOBBQIRLTB-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4N2O.Sm/c2-1(3)4;/h(H4,2,3,4);.
What are the key properties of samarium;urea?
samarium;urea has a molecular weight of 210.42 g/mol, XLogP of -0.98, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for samarium;urea is sourced from PubChem (CID 175944196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).