C3H8ClN3O — CID 11423629
(1,3-diamino-3-oxopropylidene)azanium chloride (PubChem CID 11423629) has the molecular formula C3H8ClN3O and a molecular weight of 137.57 g/mol. Its IUPAC name is (1,3-diamino-3-oxopropylidene)azanium chloride.
| Compound Name | (1,3-diamino-3-oxopropylidene)azanium chloride |
|---|---|
| PubChem CID | 11423629 |
| Molecular Formula | C3H8ClN3O |
| Molecular Weight | 137.57 g/mol |
| Exact Mass | 137.04 |
| IUPAC Name | (1,3-diamino-3-oxopropylidene)azanium chloride |
| SMILES | NC(=[NH2+])CC(N)=O.[Cl-] |
| InChI | InChI=1S/C3H7N3O.ClH/c4-2(5)1-3(6)7;/h1H2,(H3,4,5)(H2,6,7);1H |
| InChIKey | MPRLIYNSZYJODI-UHFFFAOYSA-N |
| XLogP | -6.02 |
| TPSA | 94.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.57 |
| LogP ≤ 5 | -6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|