C14H16N2O4 — CID 154143629
4-[4-(4-amino-2,4-dioxobutyl)phenyl]-3-oxobutanamide (PubChem CID 154143629) has the molecular formula C14H16N2O4 and a molecular weight of 276.29 g/mol. Its IUPAC name is 4-[4-(4-amino-2,4-dioxobutyl)phenyl]-3-oxobutanamide.
| Compound Name | 4-[4-(4-amino-2,4-dioxobutyl)phenyl]-3-oxobutanamide |
|---|---|
| PubChem CID | 154143629 |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | 4-[4-(4-amino-2,4-dioxobutyl)phenyl]-3-oxobutanamide |
| SMILES | NC(=O)CC(=O)Cc1ccc(CC(=O)CC(N)=O)cc1 |
| InChI | InChI=1S/C14H16N2O4/c15-13(19)7-11(17)5-9-1-2-10(4-3-9)6-12(18)8-14(16)20/h1-4H,5-8H2,(H2,15,19)(H2,16,20) |
| InChIKey | WHGHFJHQSWJVAP-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|