C19H20O2 — CID 158369503
1,5-bis(4-methylphenyl)pentane-2,4-dione (PubChem CID 158369503) has the molecular formula C19H20O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1,5-bis(4-methylphenyl)pentane-2,4-dione.
| Compound Name | 1,5-bis(4-methylphenyl)pentane-2,4-dione |
|---|---|
| PubChem CID | 158369503 |
| Molecular Formula | C19H20O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | 1,5-bis(4-methylphenyl)pentane-2,4-dione |
| SMILES | Cc1ccc(CC(=O)CC(=O)Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H20O2/c1-14-3-7-16(8-4-14)11-18(20)13-19(21)12-17-9-5-15(2)6-10-17/h3-10H,11-13H2,1-2H3 |
| InChIKey | GULBTZOLCISEAR-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|