C32H48O2 — CID 159337751
1,5-bis(4-methylphenyl)pentane-2,4-dione;2,2,3,3,4,4,5-heptamethylhexane (PubChem CID 159337751) has the molecular formula C32H48O2 and a molecular weight of 464.73 g/mol. Its IUPAC name is 1,5-bis(4-methylphenyl)pentane-2,4-dione;2,2,3,3,4,4,5-heptamethylhexane.
| Compound Name | 1,5-bis(4-methylphenyl)pentane-2,4-dione;2,2,3,3,4,4,5-heptamethylhexane |
|---|---|
| PubChem CID | 159337751 |
| Molecular Formula | C32H48O2 |
| Molecular Weight | 464.73 g/mol |
| Exact Mass | 464.37 |
| IUPAC Name | 1,5-bis(4-methylphenyl)pentane-2,4-dione;2,2,3,3,4,4,5-heptamethylhexane |
| SMILES | CC(C)C(C)(C)C(C)(C)C(C)(C)C.Cc1ccc(CC(=O)CC(=O)Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C19H20O2.C13H28/c1-14-3-7-16(8-4-14)11-18(20)13-19(21)12-17-9-5-15(2)6-10-17;1-10(2)12(6,7)13(8,9)11(3,4)5/h3-10H,11-13H2,1-2H3;10H,1-9H3 |
| InChIKey | LFTIBJVGBCIZMD-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.73 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|