About lithium;carbanide;2-(4-methylphenyl)acetic acid
lithium;carbanide;2-(4-methylphenyl)acetic acid (PubChem CID 161212911) has the molecular formula C10H13LiO2
and a molecular weight of 172.15 g/mol. Its IUPAC name is lithium;carbanide;2-(4-methylphenyl)acetic acid.
Molecular Properties
| Compound Name | lithium;carbanide;2-(4-methylphenyl)acetic acid |
| PubChem CID | 161212911 |
| Molecular Formula | C10H13LiO2 |
| Molecular Weight | 172.15 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | lithium;carbanide;2-(4-methylphenyl)acetic acid |
| SMILES | Cc1ccc(CC(=O)O)cc1.[CH3-].[Li+] |
| InChI | InChI=1S/C9H10O2.CH3.Li/c1-7-2-4-8(5-3-7)6-9(10)11;;/h2-5H,6H2,1H3,(H,10,11);1H3;/q;-1;+1 |
| InChIKey | XTPODRDJMARIGR-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.15 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze lithium;carbanide;2-(4-methylphenyl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;carbanide;2-(4-methylphenyl)acetic acid?
The IUPAC name of lithium;carbanide;2-(4-methylphenyl)acetic acid (CID 161212911) is lithium;carbanide;2-(4-methylphenyl)acetic acid.
What is the SMILES notation for lithium;carbanide;2-(4-methylphenyl)acetic acid?
The canonical SMILES for lithium;carbanide;2-(4-methylphenyl)acetic acid is Cc1ccc(CC(=O)O)cc1.[CH3-].[Li+].
What is the InChIKey of lithium;carbanide;2-(4-methylphenyl)acetic acid?
The InChIKey is XTPODRDJMARIGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O2.CH3.Li/c1-7-2-4-8(5-3-7)6-9(10)11;;/h2-5H,6H2,1H3,(H,10,11);1H3;/q;-1;+1.
What are the key properties of lithium;carbanide;2-(4-methylphenyl)acetic acid?
lithium;carbanide;2-(4-methylphenyl)acetic acid has a molecular weight of 172.15 g/mol, XLogP of -0.92, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;carbanide;2-(4-methylphenyl)acetic acid is sourced from PubChem (CID 161212911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).