C8H15N4O2+ — CID 144517078
[(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium (PubChem CID 144517078) has the molecular formula C8H15N4O2+ and a molecular weight of 199.23 g/mol. Its IUPAC name is [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium.
| Compound Name | [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium |
|---|---|
| PubChem CID | 144517078 |
| Molecular Formula | C8H15N4O2+ |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium |
| SMILES | CNC(=O)/C(C(=[NH2+])CC(N)=O)=C(/C)N |
| InChI | InChI=1S/C8H14N4O2/c1-4(9)7(8(14)12-2)5(10)3-6(11)13/h10H,3,9H2,1-2H3,(H2,11,13)(H,12,14)/p+1/b7-4-,10-5? |
| InChIKey | ZIOOYEXWVLHGFP-IKACFYPVSA-O |
| XLogP | -2.96 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|