About [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium
[(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium (PubChem CID 144517078) has the molecular formula C8H15N4O2+
and a molecular weight of 199.23 g/mol. Its IUPAC name is [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium.
Molecular Properties
| Compound Name | [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium |
| PubChem CID | 144517078 |
| Molecular Formula | C8H15N4O2+ |
| Molecular Weight | 199.23 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium |
| SMILES | CNC(=O)/C(C(=[NH2+])CC(N)=O)=C(/C)N |
| InChI | InChI=1S/C8H14N4O2/c1-4(9)7(8(14)12-2)5(10)3-6(11)13/h10H,3,9H2,1-2H3,(H2,11,13)(H,12,14)/p+1/b7-4-,10-5? |
| InChIKey | ZIOOYEXWVLHGFP-IKACFYPVSA-O |
| XLogP | -2.96 |
| TPSA | 123.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.23 |
| LogP ≤ 5 | -2.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium?
The IUPAC name of [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium (CID 144517078) is [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium.
What is the SMILES notation for [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium?
The canonical SMILES for [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium is CNC(=O)/C(C(=[NH2+])CC(N)=O)=C(/C)N.
What is the InChIKey of [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium?
The InChIKey is ZIOOYEXWVLHGFP-IKACFYPVSA-O. The full InChI is InChI=1S/C8H14N4O2/c1-4(9)7(8(14)12-2)5(10)3-6(11)13/h10H,3,9H2,1-2H3,(H2,11,13)(H,12,14)/p+1/b7-4-,10-5?.
What are the key properties of [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium?
[(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium has a molecular weight of 199.23 g/mol, XLogP of -2.96, 4 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1,5-diamino-4-(methylcarbamoyl)-1-oxohex-4-en-3-ylidene]azanium is sourced from PubChem (CID 144517078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).