C4H8N2O2 — CID 169438737
N,N'-di((113C)methyl)oxamide (PubChem CID 169438737) has the molecular formula C4H8N2O2 and a molecular weight of 120.09 g/mol. Its IUPAC name is N,N'-di((113C)methyl)oxamide.
| Compound Name | N,N'-di((113C)methyl)oxamide |
|---|---|
| PubChem CID | 169438737 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 120.09 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | N,N'-di((113C)methyl)oxamide |
| SMILES | [13CH3]N[13C](=O)[13C](=O)N[13CH3] |
| InChI | InChI=1S/C4H8N2O2/c1-5-3(7)4(8)6-2/h1-2H3,(H,5,7)(H,6,8)/i1+1,2+1,3+1,4+1 |
| InChIKey | IPZCJUOJSODZNK-JCDJMFQYSA-N |
| XLogP | -1.52 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.09 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|