About methanesulfonamide;N-methyl-N'-sulfanyloxamide
methanesulfonamide;N-methyl-N'-sulfanyloxamide (PubChem CID 146316765) has the molecular formula C4H11N3O4S2
and a molecular weight of 229.28 g/mol. Its IUPAC name is methanesulfonamide;N-methyl-N'-sulfanyloxamide.
Molecular Properties
| Compound Name | methanesulfonamide;N-methyl-N'-sulfanyloxamide |
| PubChem CID | 146316765 |
| Molecular Formula | C4H11N3O4S2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.02 |
| IUPAC Name | methanesulfonamide;N-methyl-N'-sulfanyloxamide |
| SMILES | CNC(=O)C(=O)NS.CS(N)(=O)=O |
| InChI | InChI=1S/C3H6N2O2S.CH5NO2S/c1-4-2(6)3(7)5-8;1-5(2,3)4/h8H,1H3,(H,4,6)(H,5,7);1H3,(H2,2,3,4) |
| InChIKey | SSIIBFQOFIBGFN-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonamide;N-methyl-N'-sulfanyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonamide;N-methyl-N'-sulfanyloxamide?
The IUPAC name of methanesulfonamide;N-methyl-N'-sulfanyloxamide (CID 146316765) is methanesulfonamide;N-methyl-N'-sulfanyloxamide.
What is the SMILES notation for methanesulfonamide;N-methyl-N'-sulfanyloxamide?
The canonical SMILES for methanesulfonamide;N-methyl-N'-sulfanyloxamide is CNC(=O)C(=O)NS.CS(N)(=O)=O.
What is the InChIKey of methanesulfonamide;N-methyl-N'-sulfanyloxamide?
The InChIKey is SSIIBFQOFIBGFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2O2S.CH5NO2S/c1-4-2(6)3(7)5-8;1-5(2,3)4/h8H,1H3,(H,4,6)(H,5,7);1H3,(H2,2,3,4).
What are the key properties of methanesulfonamide;N-methyl-N'-sulfanyloxamide?
methanesulfonamide;N-methyl-N'-sulfanyloxamide has a molecular weight of 229.28 g/mol, XLogP of -2.40, 0 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonamide;N-methyl-N'-sulfanyloxamide is sourced from PubChem (CID 146316765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).