About methanesulfonamide;propane
methanesulfonamide;propane (PubChem CID 158760342) has the molecular formula C5H18N2O4S2
and a molecular weight of 234.34 g/mol. Its IUPAC name is methanesulfonamide;propane.
Molecular Properties
| Compound Name | methanesulfonamide;propane |
| PubChem CID | 158760342 |
| Molecular Formula | C5H18N2O4S2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | methanesulfonamide;propane |
| SMILES | CCC.CS(N)(=O)=O.CS(N)(=O)=O |
| InChI | InChI=1S/C3H8.2CH5NO2S/c1-3-2;2*1-5(2,3)4/h3H2,1-2H3;2*1H3,(H2,2,3,4) |
| InChIKey | IOOWCGOBSLTNTL-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methanesulfonamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonamide;propane?
The IUPAC name of methanesulfonamide;propane (CID 158760342) is methanesulfonamide;propane.
What is the SMILES notation for methanesulfonamide;propane?
The canonical SMILES for methanesulfonamide;propane is CCC.CS(N)(=O)=O.CS(N)(=O)=O.
What is the InChIKey of methanesulfonamide;propane?
The InChIKey is IOOWCGOBSLTNTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H8.2CH5NO2S/c1-3-2;2*1-5(2,3)4/h3H2,1-2H3;2*1H3,(H2,2,3,4).
What are the key properties of methanesulfonamide;propane?
methanesulfonamide;propane has a molecular weight of 234.34 g/mol, XLogP of -0.77, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonamide;propane is sourced from PubChem (CID 158760342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).