C7H20N2O4S2 — CID 158705788
N,N-diethylmethanesulfonamide;ethanesulfonamide (PubChem CID 158705788) has the molecular formula C7H20N2O4S2 and a molecular weight of 260.38 g/mol. Its IUPAC name is N,N-diethylmethanesulfonamide;ethanesulfonamide.
| Compound Name | N,N-diethylmethanesulfonamide;ethanesulfonamide |
|---|---|
| PubChem CID | 158705788 |
| Molecular Formula | C7H20N2O4S2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | N,N-diethylmethanesulfonamide;ethanesulfonamide |
| SMILES | CCN(CC)S(C)(=O)=O.CCS(N)(=O)=O |
| InChI | InChI=1S/C5H13NO2S.C2H7NO2S/c1-4-6(5-2)9(3,7)8;1-2-6(3,4)5/h4-5H2,1-3H3;2H2,1H3,(H2,3,4,5) |
| InChIKey | IICAFTFDCSMLLZ-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |