About methanesulfonamide;propan-2-one
methanesulfonamide;propan-2-one (PubChem CID 158339378) has the molecular formula C4H11NO3S
and a molecular weight of 153.20 g/mol. Its IUPAC name is methanesulfonamide;propan-2-one.
Molecular Properties
| Compound Name | methanesulfonamide;propan-2-one |
| PubChem CID | 158339378 |
| Molecular Formula | C4H11NO3S |
| Molecular Weight | 153.20 g/mol |
| Exact Mass | 153.05 |
| IUPAC Name | methanesulfonamide;propan-2-one |
| SMILES | CC(C)=O.CS(N)(=O)=O |
| InChI | InChI=1S/C3H6O.CH5NO2S/c1-3(2)4;1-5(2,3)4/h1-2H3;1H3,(H2,2,3,4) |
| InChIKey | GQYVRMFLCQVWOK-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.20 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanesulfonamide;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonamide;propan-2-one?
The IUPAC name of methanesulfonamide;propan-2-one (CID 158339378) is methanesulfonamide;propan-2-one.
What is the SMILES notation for methanesulfonamide;propan-2-one?
The canonical SMILES for methanesulfonamide;propan-2-one is CC(C)=O.CS(N)(=O)=O.
What is the InChIKey of methanesulfonamide;propan-2-one?
The InChIKey is GQYVRMFLCQVWOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.CH5NO2S/c1-3(2)4;1-5(2,3)4/h1-2H3;1H3,(H2,2,3,4).
What are the key properties of methanesulfonamide;propan-2-one?
methanesulfonamide;propan-2-one has a molecular weight of 153.20 g/mol, XLogP of -0.50, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonamide;propan-2-one is sourced from PubChem (CID 158339378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).