About methane;methylsulfonylmethane;propan-2-one
methane;methylsulfonylmethane;propan-2-one (PubChem CID 169426360) has the molecular formula C6H16O3S
and a molecular weight of 168.26 g/mol. Its IUPAC name is methane;methylsulfonylmethane;propan-2-one.
Molecular Properties
| Compound Name | methane;methylsulfonylmethane;propan-2-one |
| PubChem CID | 169426360 |
| Molecular Formula | C6H16O3S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | methane;methylsulfonylmethane;propan-2-one |
| SMILES | C.CC(C)=O.CS(C)(=O)=O |
| InChI | InChI=1S/C3H6O.C2H6O2S.CH4/c1-3(2)4;1-5(2,3)4;/h1-2H3;1-2H3;1H4 |
| InChIKey | JAOXPBITTJXBGM-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methane;methylsulfonylmethane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;methylsulfonylmethane;propan-2-one?
The IUPAC name of methane;methylsulfonylmethane;propan-2-one (CID 169426360) is methane;methylsulfonylmethane;propan-2-one.
What is the SMILES notation for methane;methylsulfonylmethane;propan-2-one?
The canonical SMILES for methane;methylsulfonylmethane;propan-2-one is C.CC(C)=O.CS(C)(=O)=O.
What is the InChIKey of methane;methylsulfonylmethane;propan-2-one?
The InChIKey is JAOXPBITTJXBGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C2H6O2S.CH4/c1-3(2)4;1-5(2,3)4;/h1-2H3;1-2H3;1H4.
What are the key properties of methane;methylsulfonylmethane;propan-2-one?
methane;methylsulfonylmethane;propan-2-one has a molecular weight of 168.26 g/mol, XLogP of 0.89, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;methylsulfonylmethane;propan-2-one is sourced from PubChem (CID 169426360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).