About butane-2,3-dione;methylsulfonylsulfonylmethane
butane-2,3-dione;methylsulfonylsulfonylmethane (PubChem CID 158437729) has the molecular formula C6H12O6S2
and a molecular weight of 244.29 g/mol. Its IUPAC name is butane-2,3-dione;methylsulfonylsulfonylmethane.
Molecular Properties
| Compound Name | butane-2,3-dione;methylsulfonylsulfonylmethane |
| PubChem CID | 158437729 |
| Molecular Formula | C6H12O6S2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | butane-2,3-dione;methylsulfonylsulfonylmethane |
| SMILES | CC(=O)C(C)=O.CS(=O)(=O)S(C)(=O)=O |
| InChI | InChI=1S/C4H6O2.C2H6O4S2/c1-3(5)4(2)6;1-7(3,4)8(2,5)6/h1-2H3;1-2H3 |
| InChIKey | HCLAKJXPMIUQQT-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze butane-2,3-dione;methylsulfonylsulfonylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane-2,3-dione;methylsulfonylsulfonylmethane?
The IUPAC name of butane-2,3-dione;methylsulfonylsulfonylmethane (CID 158437729) is butane-2,3-dione;methylsulfonylsulfonylmethane.
What is the SMILES notation for butane-2,3-dione;methylsulfonylsulfonylmethane?
The canonical SMILES for butane-2,3-dione;methylsulfonylsulfonylmethane is CC(=O)C(C)=O.CS(=O)(=O)S(C)(=O)=O.
What is the InChIKey of butane-2,3-dione;methylsulfonylsulfonylmethane?
The InChIKey is HCLAKJXPMIUQQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C2H6O4S2/c1-3(5)4(2)6;1-7(3,4)8(2,5)6/h1-2H3;1-2H3.
What are the key properties of butane-2,3-dione;methylsulfonylsulfonylmethane?
butane-2,3-dione;methylsulfonylsulfonylmethane has a molecular weight of 244.29 g/mol, XLogP of -0.85, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for butane-2,3-dione;methylsulfonylsulfonylmethane is sourced from PubChem (CID 158437729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).