About lithium acetylazanide
lithium acetylazanide (PubChem CID 13311602) has the molecular formula C2H4LiNO
and a molecular weight of 65.00 g/mol. Its IUPAC name is lithium acetylazanide.
Molecular Properties
| Compound Name | lithium acetylazanide |
| PubChem CID | 13311602 |
| Molecular Formula | C2H4LiNO |
| Molecular Weight | 65.00 g/mol |
| Exact Mass | 65.05 |
| IUPAC Name | lithium acetylazanide |
| SMILES | CC([NH-])=O.[Li+] |
| InChI | InChI=1S/C2H5NO.Li/c1-2(3)4;/h1H3,(H2,3,4);/q;+1/p-1 |
| InChIKey | ZIVZCCKMPFVIPJ-UHFFFAOYSA-M |
| XLogP | -2.41 |
| TPSA | 40.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 65.00 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium acetylazanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium acetylazanide?
The IUPAC name of lithium acetylazanide (CID 13311602) is lithium acetylazanide.
What is the SMILES notation for lithium acetylazanide?
The canonical SMILES for lithium acetylazanide is CC([NH-])=O.[Li+].
What is the InChIKey of lithium acetylazanide?
The InChIKey is ZIVZCCKMPFVIPJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H5NO.Li/c1-2(3)4;/h1H3,(H2,3,4);/q;+1/p-1.
What are the key properties of lithium acetylazanide?
lithium acetylazanide has a molecular weight of 65.00 g/mol, XLogP of -2.41, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium acetylazanide is sourced from PubChem (CID 13311602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).