About CID 5359261
CID 5359261 (PubChem CID 5359261) has the molecular formula C2H3O2
and a molecular weight of 59.04 g/mol.
Molecular Properties
| Compound Name | CID 5359261 |
| PubChem CID | 5359261 |
| Molecular Formula | C2H3O2 |
| Molecular Weight | 59.04 g/mol |
| Exact Mass | 59.01 |
| IUPAC Name | — |
| SMILES | CC([O])=O |
| InChI | InChI=1S/C2H3O2/c1-2(3)4/h1H3 |
| InChIKey | UXTFKIJKRJJXNV-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 36.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 4 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 59.04 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 5359261 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 5359261?
The IUPAC name of CID 5359261 (CID 5359261) is not available.
What is the SMILES notation for CID 5359261?
The canonical SMILES for CID 5359261 is CC([O])=O.
What is the InChIKey of CID 5359261?
The InChIKey is UXTFKIJKRJJXNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H3O2/c1-2(3)4/h1H3.
What are the key properties of CID 5359261?
CID 5359261 has a molecular weight of 59.04 g/mol, XLogP of -0.04, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 5359261 is sourced from PubChem (CID 5359261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).