About CID 72786756
CID 72786756 (PubChem CID 72786756) has the molecular formula C2H8O6PbS2
and a molecular weight of 399.41 g/mol.
Molecular Properties
| Compound Name | CID 72786756 |
| PubChem CID | 72786756 |
| Molecular Formula | C2H8O6PbS2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | — |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.[Pb] |
| InChI | InChI=1S/2CH4O3S.Pb/c2*1-5(2,3)4;/h2*1H3,(H,2,3,4); |
| InChIKey | CPPJKGQUFWEUCB-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze CID 72786756 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 72786756?
The IUPAC name of CID 72786756 (CID 72786756) is not available.
What is the SMILES notation for CID 72786756?
The canonical SMILES for CID 72786756 is CS(=O)(=O)O.CS(=O)(=O)O.[Pb].
What is the InChIKey of CID 72786756?
The InChIKey is CPPJKGQUFWEUCB-UHFFFAOYSA-N. The full InChI is InChI=1S/2CH4O3S.Pb/c2*1-5(2,3)4;/h2*1H3,(H,2,3,4);.
What are the key properties of CID 72786756?
CID 72786756 has a molecular weight of 399.41 g/mol, XLogP of -1.37, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 72786756 is sourced from PubChem (CID 72786756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).