About methanesulfonic acid;hydrate
methanesulfonic acid;hydrate (PubChem CID 87278985) has the molecular formula C2H10O7S2
and a molecular weight of 210.23 g/mol. Its IUPAC name is methanesulfonic acid;hydrate.
Molecular Properties
| Compound Name | methanesulfonic acid;hydrate |
| PubChem CID | 87278985 |
| Molecular Formula | C2H10O7S2 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 209.99 |
| IUPAC Name | methanesulfonic acid;hydrate |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.O |
| InChI | InChI=1S/2CH4O3S.H2O/c2*1-5(2,3)4;/h2*1H3,(H,2,3,4);1H2 |
| InChIKey | QLYCZINKZANMRY-UHFFFAOYSA-N |
| XLogP | -1.82 |
| TPSA | 140.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonic acid;hydrate?
The IUPAC name of methanesulfonic acid;hydrate (CID 87278985) is methanesulfonic acid;hydrate.
What is the SMILES notation for methanesulfonic acid;hydrate?
The canonical SMILES for methanesulfonic acid;hydrate is CS(=O)(=O)O.CS(=O)(=O)O.O.
What is the InChIKey of methanesulfonic acid;hydrate?
The InChIKey is QLYCZINKZANMRY-UHFFFAOYSA-N. The full InChI is InChI=1S/2CH4O3S.H2O/c2*1-5(2,3)4;/h2*1H3,(H,2,3,4);1H2.
What are the key properties of methanesulfonic acid;hydrate?
methanesulfonic acid;hydrate has a molecular weight of 210.23 g/mol, XLogP of -1.82, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonic acid;hydrate is sourced from PubChem (CID 87278985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).