About ethane;methanesulfonic acid
ethane;methanesulfonic acid (PubChem CID 87194848) has the molecular formula C4H14O6S2
and a molecular weight of 222.28 g/mol. Its IUPAC name is ethane;methanesulfonic acid.
Molecular Properties
| Compound Name | ethane;methanesulfonic acid |
| PubChem CID | 87194848 |
| Molecular Formula | C4H14O6S2 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | ethane;methanesulfonic acid |
| SMILES | CC.CS(=O)(=O)O.CS(=O)(=O)O |
| InChI | InChI=1S/C2H6.2CH4O3S/c1-2;2*1-5(2,3)4/h1-2H3;2*1H3,(H,2,3,4) |
| InChIKey | RYSRRQRKJUEFRT-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanesulfonic acid?
The IUPAC name of ethane;methanesulfonic acid (CID 87194848) is ethane;methanesulfonic acid.
What is the SMILES notation for ethane;methanesulfonic acid?
The canonical SMILES for ethane;methanesulfonic acid is CC.CS(=O)(=O)O.CS(=O)(=O)O.
What is the InChIKey of ethane;methanesulfonic acid?
The InChIKey is RYSRRQRKJUEFRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6.2CH4O3S/c1-2;2*1-5(2,3)4/h1-2H3;2*1H3,(H,2,3,4).
What are the key properties of ethane;methanesulfonic acid?
ethane;methanesulfonic acid has a molecular weight of 222.28 g/mol, XLogP of 0.03, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanesulfonic acid is sourced from PubChem (CID 87194848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).