About ethane;N-methyl-2-oxobutanamide
ethane;N-methyl-2-oxobutanamide (PubChem CID 143884065) has the molecular formula C9H21NO2
and a molecular weight of 175.27 g/mol. Its IUPAC name is ethane;N-methyl-2-oxobutanamide.
Molecular Properties
| Compound Name | ethane;N-methyl-2-oxobutanamide |
| PubChem CID | 143884065 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | ethane;N-methyl-2-oxobutanamide |
| SMILES | CC.CC.CCC(=O)C(=O)NC |
| InChI | InChI=1S/C5H9NO2.2C2H6/c1-3-4(7)5(8)6-2;2*1-2/h3H2,1-2H3,(H,6,8);2*1-2H3 |
| InChIKey | BDLXQQNZPNKNKU-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-methyl-2-oxobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-methyl-2-oxobutanamide?
The IUPAC name of ethane;N-methyl-2-oxobutanamide (CID 143884065) is ethane;N-methyl-2-oxobutanamide.
What is the SMILES notation for ethane;N-methyl-2-oxobutanamide?
The canonical SMILES for ethane;N-methyl-2-oxobutanamide is CC.CC.CCC(=O)C(=O)NC.
What is the InChIKey of ethane;N-methyl-2-oxobutanamide?
The InChIKey is BDLXQQNZPNKNKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.2C2H6/c1-3-4(7)5(8)6-2;2*1-2/h3H2,1-2H3,(H,6,8);2*1-2H3.
What are the key properties of ethane;N-methyl-2-oxobutanamide?
ethane;N-methyl-2-oxobutanamide has a molecular weight of 175.27 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-methyl-2-oxobutanamide is sourced from PubChem (CID 143884065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).