About azane;N-methyl-2-methylidenepentanamide
azane;N-methyl-2-methylidenepentanamide (PubChem CID 174850650) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is azane;N-methyl-2-methylidenepentanamide.
Molecular Properties
| Compound Name | azane;N-methyl-2-methylidenepentanamide |
| PubChem CID | 174850650 |
| Molecular Formula | C7H16N2O |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.13 |
| IUPAC Name | azane;N-methyl-2-methylidenepentanamide |
| SMILES | C=C(CCC)C(=O)NC.N |
| InChI | InChI=1S/C7H13NO.H3N/c1-4-5-6(2)7(9)8-3;/h2,4-5H2,1,3H3,(H,8,9);1H3 |
| InChIKey | BVZGORSVCXTKTE-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;N-methyl-2-methylidenepentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N-methyl-2-methylidenepentanamide?
The IUPAC name of azane;N-methyl-2-methylidenepentanamide (CID 174850650) is azane;N-methyl-2-methylidenepentanamide.
What is the SMILES notation for azane;N-methyl-2-methylidenepentanamide?
The canonical SMILES for azane;N-methyl-2-methylidenepentanamide is C=C(CCC)C(=O)NC.N.
What is the InChIKey of azane;N-methyl-2-methylidenepentanamide?
The InChIKey is BVZGORSVCXTKTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO.H3N/c1-4-5-6(2)7(9)8-3;/h2,4-5H2,1,3H3,(H,8,9);1H3.
What are the key properties of azane;N-methyl-2-methylidenepentanamide?
azane;N-methyl-2-methylidenepentanamide has a molecular weight of 144.22 g/mol, XLogP of 1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-methyl-2-methylidenepentanamide is sourced from PubChem (CID 174850650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).