About N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride
N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride (PubChem CID 141246092) has the molecular formula C8H18ClN3O
and a molecular weight of 207.70 g/mol. Its IUPAC name is N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride.
Molecular Properties
| Compound Name | N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride |
| PubChem CID | 141246092 |
| Molecular Formula | C8H18ClN3O |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride |
| SMILES | C=C(CCC)C(=O)N(NC)NC.Cl |
| InChI | InChI=1S/C8H17N3O.ClH/c1-5-6-7(2)8(12)11(9-3)10-4;/h9-10H,2,5-6H2,1,3-4H3;1H |
| InChIKey | DBFFNAJEUSSKFE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride?
The IUPAC name of N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride (CID 141246092) is N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride.
What is the SMILES notation for N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride?
The canonical SMILES for N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride is C=C(CCC)C(=O)N(NC)NC.Cl.
What is the InChIKey of N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride?
The InChIKey is DBFFNAJEUSSKFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3O.ClH/c1-5-6-7(2)8(12)11(9-3)10-4;/h9-10H,2,5-6H2,1,3-4H3;1H.
What are the key properties of N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride?
N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride has a molecular weight of 207.70 g/mol, XLogP of 0.86, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride is sourced from PubChem (CID 141246092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).