C8H18ClN3O — CID 141246092
N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride (PubChem CID 141246092) has the molecular formula C8H18ClN3O and a molecular weight of 207.70 g/mol. Its IUPAC name is N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride.
| Compound Name | N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride |
|---|---|
| PubChem CID | 141246092 |
| Molecular Formula | C8H18ClN3O |
| Molecular Weight | 207.70 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | N,N-bis(methylamino)-2-methylidenepentanamide;hydrochloride |
| SMILES | C=C(CCC)C(=O)N(NC)NC.Cl |
| InChI | InChI=1S/C8H17N3O.ClH/c1-5-6-7(2)8(12)11(9-3)10-4;/h9-10H,2,5-6H2,1,3-4H3;1H |
| InChIKey | DBFFNAJEUSSKFE-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.70 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|