C7H15N3O — CID 141246091
N,N-bis(methylamino)-2-methylidenebutanamide (PubChem CID 141246091) has the molecular formula C7H15N3O and a molecular weight of 157.22 g/mol. Its IUPAC name is N,N-bis(methylamino)-2-methylidenebutanamide.
| Compound Name | N,N-bis(methylamino)-2-methylidenebutanamide |
|---|---|
| PubChem CID | 141246091 |
| Molecular Formula | C7H15N3O |
| Molecular Weight | 157.22 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | N,N-bis(methylamino)-2-methylidenebutanamide |
| SMILES | C=C(CC)C(=O)N(NC)NC |
| InChI | InChI=1S/C7H15N3O/c1-5-6(2)7(11)10(8-3)9-4/h8-9H,2,5H2,1,3-4H3 |
| InChIKey | ZSHDJLLYSXAKMD-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|