About chloromethane;methylamino 2-methylidenebutanoate
chloromethane;methylamino 2-methylidenebutanoate (PubChem CID 159451589) has the molecular formula C7H14ClNO2
and a molecular weight of 179.65 g/mol. Its IUPAC name is chloromethane;methylamino 2-methylidenebutanoate.
Molecular Properties
| Compound Name | chloromethane;methylamino 2-methylidenebutanoate |
| PubChem CID | 159451589 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | chloromethane;methylamino 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)ONC.CCl |
| InChI | InChI=1S/C6H11NO2.CH3Cl/c1-4-5(2)6(8)9-7-3;1-2/h7H,2,4H2,1,3H3;1H3 |
| InChIKey | LTLHFVOEHMTZHT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;methylamino 2-methylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;methylamino 2-methylidenebutanoate?
The IUPAC name of chloromethane;methylamino 2-methylidenebutanoate (CID 159451589) is chloromethane;methylamino 2-methylidenebutanoate.
What is the SMILES notation for chloromethane;methylamino 2-methylidenebutanoate?
The canonical SMILES for chloromethane;methylamino 2-methylidenebutanoate is C=C(CC)C(=O)ONC.CCl.
What is the InChIKey of chloromethane;methylamino 2-methylidenebutanoate?
The InChIKey is LTLHFVOEHMTZHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.CH3Cl/c1-4-5(2)6(8)9-7-3;1-2/h7H,2,4H2,1,3H3;1H3.
What are the key properties of chloromethane;methylamino 2-methylidenebutanoate?
chloromethane;methylamino 2-methylidenebutanoate has a molecular weight of 179.65 g/mol, XLogP of 1.49, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;methylamino 2-methylidenebutanoate is sourced from PubChem (CID 159451589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).