About 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate
2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate (PubChem CID 175091133) has the molecular formula C12H23NO4
and a molecular weight of 245.32 g/mol. Its IUPAC name is 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate |
| PubChem CID | 175091133 |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.C=C(CC)C(=O)O.CNC |
| InChI | InChI=1S/2C5H8O2.C2H7N/c1-4(2)5(6)7-3;1-3-4(2)5(6)7;1-3-2/h1H2,2-3H3;2-3H2,1H3,(H,6,7);3H,1-2H3 |
| InChIKey | ZDGNXHJZUGXFEB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate?
The IUPAC name of 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate (CID 175091133) is 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate.
What is the SMILES notation for 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate?
The canonical SMILES for 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate is C=C(C)C(=O)OC.C=C(CC)C(=O)O.CNC.
What is the InChIKey of 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate?
The InChIKey is ZDGNXHJZUGXFEB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H8O2.C2H7N/c1-4(2)5(6)7-3;1-3-4(2)5(6)7;1-3-2/h1H2,2-3H3;2-3H2,1H3,(H,6,7);3H,1-2H3.
What are the key properties of 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate?
2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate has a molecular weight of 245.32 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidenebutanoic acid;N-methylmethanamine;methyl 2-methylprop-2-enoate is sourced from PubChem (CID 175091133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).