About methylamino 2-aminoprop-2-enoate
methylamino 2-aminoprop-2-enoate (PubChem CID 155065198) has the molecular formula C4H8N2O2
and a molecular weight of 116.12 g/mol. Its IUPAC name is methylamino 2-aminoprop-2-enoate.
Molecular Properties
| Compound Name | methylamino 2-aminoprop-2-enoate |
| PubChem CID | 155065198 |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.06 |
| IUPAC Name | methylamino 2-aminoprop-2-enoate |
| SMILES | C=C(N)C(=O)ONC |
| InChI | InChI=1S/C4H8N2O2/c1-3(5)4(7)8-6-2/h6H,1,5H2,2H3 |
| InChIKey | FYTCIAPQUVJYOK-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methylamino 2-aminoprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylamino 2-aminoprop-2-enoate?
The IUPAC name of methylamino 2-aminoprop-2-enoate (CID 155065198) is methylamino 2-aminoprop-2-enoate.
What is the SMILES notation for methylamino 2-aminoprop-2-enoate?
The canonical SMILES for methylamino 2-aminoprop-2-enoate is C=C(N)C(=O)ONC.
What is the InChIKey of methylamino 2-aminoprop-2-enoate?
The InChIKey is FYTCIAPQUVJYOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O2/c1-3(5)4(7)8-6-2/h6H,1,5H2,2H3.
What are the key properties of methylamino 2-aminoprop-2-enoate?
methylamino 2-aminoprop-2-enoate has a molecular weight of 116.12 g/mol, XLogP of -0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methylamino 2-aminoprop-2-enoate is sourced from PubChem (CID 155065198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).